- m-PEG8-NHS ester
-
- $0.00 / 500mg
-
2024-10-28
- CAS:756525-90-3
- Min. Order:
- Purity: 99.77%
- Supply Ability: 10g
- m-PEG8-NHS ester
-
- $0.00 / 1g
-
2024-03-27
- CAS:756525-90-3
- Min. Order: 1g
- Purity: >95.00%
- Supply Ability: 1g
|
| | m-PEG8-NHS ester Basic information |
| Product Name: | m-PEG8-NHS ester | | Synonyms: | MPEG7-NHS;MPEG7-CH2CH2COONHS Ester;1-[(1-Oxo-4,7,10,13,16,19,22,25-octaoxahexacos-1-yl)oxy]-2,5-pyrrolidinedione;4,7,10,13,16,19,22,25-Octaoxahexacosanoic acid 2,5-dioxo-1-pyrrolidinyl ester;Methyl-PEG8-NHS Ester;m-PEG8-NHS ester;MeO-dPEG(8)-NHS;(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate | | CAS: | 756525-90-3 | | MF: | C22H39NO12 | | MW: | 509.54 | | EINECS: | | | Product Categories: | | | Mol File: | 756525-90-3.mol |  |
| | m-PEG8-NHS ester Chemical Properties |
| storage temp. | -20°C | | solubility | Soluble in DMSO, DCM, DMF | | form | solid or viscous liquid | | color | Colorless to Yellow | | InChI | InChI=1S/C22H39NO12/c1-27-6-7-29-10-11-31-14-15-33-18-19-34-17-16-32-13-12-30-9-8-28-5-4-22(26)35-23-20(24)2-3-21(23)25/h2-19H2,1H3 | | InChIKey | IBZNTYBFTKFSMU-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOC | | CAS DataBase Reference | 756525-90-3 |
| | m-PEG8-NHS ester Usage And Synthesis |
| Description | m-PEG8-NHS ester is a PEG linker containing an NHS ester. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. The hydrophilic PEG spacer increases solubility in aqueous media. | | in vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker.
|
| | m-PEG8-NHS ester Preparation Products And Raw materials |
|