|
| 2-Bromo-5-ethynylpyridine Basic information |
| 2-Bromo-5-ethynylpyridine Chemical Properties |
Melting point | 83℃ | Boiling point | 231.0±25.0 °C(Predicted) | density | 1.60±0.1 g/cm3(Predicted) | storage temp. | 2-8°C | pka | -0.73±0.10(Predicted) | InChI | InChI=1S/C7H4BrN/c1-2-6-3-4-7(8)9-5-6/h1,3-5H | InChIKey | WRORYOXBXUUDJL-UHFFFAOYSA-N | SMILES | C1(Br)=NC=C(C#C)C=C1 |
| 2-Bromo-5-ethynylpyridine Usage And Synthesis |
Uses | 2-Bromo-5-ethynylpyridine is used in the synthesis of macrocycle of terpyridine units. | Preparation | The iodobromopyridine (2-Bromo-5-iodopyridine), the starting material, was coupled with TMS-acetylene under Sonogashira conditions. One-pot deprotection and recrystallization could yield the bromo,ethynyl-functionalized pyridine (2-Bromo-5-ethynylpyridine)[1].
| Reactions | 2-Bromo-5-ethynylpyridine is a useful organic compound that could be used to synthesize 2-Bromo-5-[(3-iodophenyl)ethynyl]pyridine, 2-bromo-5-({4-[(tert-butyldimethylsilyl)oxy]phenyl}ethynyl)pyridine, and so on. |
| 2-Bromo-5-ethynylpyridine Preparation Products And Raw materials |
|