| Company Name: |
Abydos Scientific
|
| Tel: |
025-84767922 18936879710 |
| Email: |
sales@abydoscientific.com |
| Products Intro: |
Product Name:(S)-Methyl 2-((S)-2-amino-4-methylpentanamido)-3-phenylpropanoate
CAS:38155-18-9
Purity:0.99 Package:1kg;100g;50g;10g
|
| Company Name: |
Jinan blalong chemical co. LTD
|
| Tel: |
2710913286@.com |
| Email: |
1513643261@qq.com |
| Products Intro: |
Product Name:CarfilzomibImpurity26
CAS:38155-18-9
Purity:99% HPLC Package:50G;10G;1G;500MG;100MG
|
| Company Name: |
SHENZHEN PHYSTANDARD BIO-TECH CO.,LTD
|
| Tel: |
0755-0755-0755-83725350 13380397412 |
| Email: |
3001280422@qq.com |
| Products Intro: |
Product Name:Carfilzomib Impurity 3
CAS:38155-18-9
Purity:99% HPLC Package:10mg;25mg;50mg;100mg
|
L-Phenylalanine, N-L-leucyl-, methyl ester manufacturers
- Carfilzomib Impurity 8
-
- $0.00 / 10mg
-
2024-09-20
- CAS:38155-18-9
- Min. Order: 10mg
- Purity: 98%
- Supply Ability: 500mg
|
| | L-Phenylalanine, N-L-leucyl-, methyl ester Basic information |
| Product Name: | L-Phenylalanine, N-L-leucyl-, methyl ester | | Synonyms: | L-Phenylalanine, N-L-leucyl-, methyl ester;methyl L-leucyl-L-phenylalaninate;DJBPSNXKZLENEZ-KBPBESRZSA-N;(S)-Methyl 2-((S)-2-amino-4-methylpentanamido)-3-phenylpropanoate;L-Phenylalanine, L-leucyl-, methyl ester;Methyl L-leucylphenylalaninate | | CAS: | 38155-18-9 | | MF: | C16H24N2O3 | | MW: | 292.37 | | EINECS: | | | Product Categories: | | | Mol File: | 38155-18-9.mol |  |
| | L-Phenylalanine, N-L-leucyl-, methyl ester Chemical Properties |
| Boiling point | 457.4±40.0 °C(Predicted) | | density | 1.088±0.06 g/cm3(Predicted) | | pka | 13.74±0.46(Predicted) | | InChI | InChI=1S/C16H24N2O3/c1-11(2)9-13(17)15(19)18-14(16(20)21-3)10-12-7-5-4-6-8-12/h4-8,11,13-14H,9-10,17H2,1-3H3,(H,18,19)/t13-,14-/m0/s1 | | InChIKey | DJBPSNXKZLENEZ-KBPBESRZSA-N | | SMILES | C(OC)(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(C)C)N |
| | L-Phenylalanine, N-L-leucyl-, methyl ester Usage And Synthesis |
| Uses | L-Phenylalanine, N-L-leucyl-, methyl ester, commonly named Carfilzomib Impurity 3, is a valuable organic compound that could be used as an impurity reference of Carfilzomib which is used alone and in combination with other medications to treat people with multiple myeloma. |
| | L-Phenylalanine, N-L-leucyl-, methyl ester Preparation Products And Raw materials |
|