|
|
| | 6-methylpurine riboside Basic information |
| Product Name: | 6-methylpurine riboside | | Synonyms: | 6-METHYLPURINE RIBOSIDE;6-Methyl-9.beta.-D-ribofuranosylpurine;6-Methylpurine ribonucleoside;9H-Purine, 6-methyl-9-.beta.-D-ribofuranosyl-;Nsc101619;6-D-MPR;6-Methylpurine-beta-D-riboside;6-Methylpurine-9-beta-D-ribofuranoside | | CAS: | 14675-48-0 | | MF: | C11H14N4O4 | | MW: | 266.25 | | EINECS: | | | Product Categories: | | | Mol File: | 14675-48-0.mol |  |
| | 6-methylpurine riboside Chemical Properties |
| Melting point | 209-210 °C | | Boiling point | 590.4±60.0 °C(Predicted) | | density | 1.81±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | 13.13±0.70(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1/C11H14N4O4/c1-5-7-10(13-3-12-5)15(4-14-7)11-9(18)8(17)6(2-16)19-11/h3-4,6,8-9,11,16-18H,2H2,1H3/t6-,8-,9-,11-/s3 | | InChIKey | FIGBCBGMUIGJBD-SOMIAQKHNA-N | | SMILES | N1(C=NC2C(C)=NC=NC1=2)[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 |&1:10,11,13,15,r| |
| | 6-methylpurine riboside Usage And Synthesis |
| Description | 6-Methylpurine-β-D-riboside (β-D-MPR; 6-methylpurine riboside), an antibiotic isolated from culture broths of the basidiomycetes fungi Collybia dryophilia and Collybia maculata, has antifungal, antiviral and antitumor activity. β-D-MPR is an excellent substrate of mammalian adenosine deaminase (ADA), and its mechanism of activation in tumor cells presumably relates to its interaction with this enzyme [1]. | | References | [1] Sufrin, J . "Improved Synthesis of β-D-6-Methylpurine Riboside and Antitumor Effects of the β-D- and α-D-Anomers." Molecules 10(2005). |
| | 6-methylpurine riboside Preparation Products And Raw materials |
|