4'-Bromo-3'-nitroacetophenone manufacturers
|
| | 4'-Bromo-3'-nitroacetophenone Basic information |
| | 4'-Bromo-3'-nitroacetophenone Chemical Properties |
| Melting point | 117-121 °C(lit.) | | Boiling point | 275.4℃ | | density | 1.637 | | refractive index | 1.6090 (estimate) | | Fp | 120.4℃ | | storage temp. | Sealed in dry,Room Temperature | | form | Amorphous Powder | | color | White to slightly yellow | | BRN | 2050098 | | InChI | InChI=1S/C8H6BrNO3/c1-5(11)6-2-3-7(9)8(4-6)10(12)13/h2-4H,1H3 | | InChIKey | YFVOFFKNHQTQQE-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(Br)C([N+]([O-])=O)=C1)C | | CAS DataBase Reference | 18640-58-9(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29147000 |
| | 4'-Bromo-3'-nitroacetophenone Usage And Synthesis |
| Chemical Properties | white to slightly yellow amorphous powder | | General Description | 4′-Bromo-3′-nitroacetophenone is an electron deficient acetophenone derivative. | | Synthesis | 4'-Bromo-3'-nitroacetophenone is synthesised using 4'-Bromoacetophenone as a raw material by chemical reaction. The specific synthesis steps are as follows:
To fuming nitric acid (200 mL), l-(4- bromophenyl)-l-propanone (1-1) (40 g, 0.20 mol) was added while keeping the inside temperature of mixture at 5 to 10 0C. The reaction solution was stirred at this temperature for 30 minutes and then poured into ice. The precipitate was collected by filtration, washed with distilled water (25 mL x 2) and re-crystallized from methanol to give 1-2 (18 g, 37percent yield). 1H NMR (500 MHz, CDCl3) δ 8.38 (IH, d, J= 2.0 Hz), 7.99 (IH, dd, J= 8.2 Hz, 2.0 Hz), 7.86 (IH, d, J= 8.2Hz), 3.01 (2H, q, J= 7.1Hz), 1.25 (3H, t, J= 7.1Hz) ppm; LC-MS (ESI): m/z 244.0 (M+H)+.
 |
| | 4'-Bromo-3'-nitroacetophenone Preparation Products And Raw materials |
|