10H-spiro[acridine-9,9'-xanthene] manufacturers
|
| | 10H-spiro[acridine-9,9'-xanthene] Basic information |
| Product Name: | 10H-spiro[acridine-9,9'-xanthene] | | Synonyms: | 10H-spiro[acridine-9,9'-xanthene];spiro[10H-acridine-9,9'-xanthene;Spiro[acridine-9(10H),9'-[9H]xanthene];10H snail [acridine 9,9 'xanthone;10H-spiro[acridine-9,9'-xanthene | | CAS: | 1443130-79-7 | | MF: | C25H17NO | | MW: | 347.41 | | EINECS: | | | Product Categories: | | | Mol File: | 1443130-79-7.mol | ![10H-spiro[acridine-9,9'-xanthene] Structure](CAS/20200119/GIF/1443130-79-7.gif) |
| | 10H-spiro[acridine-9,9'-xanthene] Chemical Properties |
| Boiling point | 497.2±45.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | pka | 1.11±0.20(Predicted) | | InChI | InChI=1S/C25H17NO/c1-5-13-21-17(9-1)25(18-10-2-6-14-22(18)26-21)19-11-3-7-15-23(19)27-24-16-8-4-12-20(24)25/h1-16,26H | | InChIKey | LRDZIHIBFOPYFK-UHFFFAOYSA-N | | SMILES | C1=C2C(NC3=C(C42C2=C(C=CC=C2)OC2=C4C=CC=C2)C=CC=C3)=CC=C1 |
| | 10H-spiro[acridine-9,9'-xanthene] Usage And Synthesis |
| Description | 10H-spiro[acridine-9,9'-xanthene] is a weak electron donor moiety. Its structure is similar to spiro[acridine-9,90 -fluorene] and their properties are similar. They all have effective donor properties and the expectation of a large dihedral angle arising from steric repulsion by the two H atoms in the peri-position. Hence, they are often used simultaneously to synthesize TADF and compare the properties of the two synthesized materials. | | Uses | 10H-spiro[acridine-9,9'-xanthene] could used as an intermediates of photoelectric materials to fabricate a TADF OLED emitter. Since its good donor properties and the expectation of a large dihedral angle arising from steric repulsion by the two H atoms in the peri-position, it was commonly selected as a wide-gap donor moiety to fabricate highly efficient blue TADF materials whit diphenylsulphone (DPS) as an electron acceptor[1]. 10H-spiro[acridine-9,9'-xanthene] is also used to construct phosphine oxide (PO) hosts through introducing one or two diphenylphosphine oxide groups at 2 and 7 positions of acridine ring, respectively. This material could used to fabricate single-emissive-layer Thermally activated delayed fluorescence (TADF) white organic light-emitting diodes[2]. | | References | [1]Lee G R, et al. Theoretical Study of Benzofuro-Pyridine Derivatives-Based Organic Light-Emitting Diodes Exhibiting Thermally Activated Delayed Fluorescence. Journal of Nanoscience and Nanotechnology, 2019; 19: 787-4790.
[2] Zhu A, et al. Phosphorylation amplified asymmetry of spiro[acridine-9,9'-xanthene] hosts for efficient blue and white thermal activated delay fluorescent diodes. Journal of Materials Chemistry C, 2023. |
| | 10H-spiro[acridine-9,9'-xanthene] Preparation Products And Raw materials |
|