|
|
| | 4-BROMO-2-FLUORO-6-NITROTOLUENE Basic information |
| Product Name: | 4-BROMO-2-FLUORO-6-NITROTOLUENE | | Synonyms: | 5-Bromo-3-fluoro-2-methylnitrobenzene;4-BROMO-2-FLUORO-6-NITROTOLUENE;5-bromo-1-fluoro-2-methyl-3-nitrobenzene;Bromo-6-fluoro-4-nitrotoluene;Benzene, 5-bromo-1-fluoro-2-methyl-3-nitro- | | CAS: | 502496-34-6 | | MF: | C7H5BrFNO2 | | MW: | 234.02 | | EINECS: | | | Product Categories: | | | Mol File: | 502496-34-6.mol |  |
| | 4-BROMO-2-FLUORO-6-NITROTOLUENE Chemical Properties |
| Boiling point | 261.7±35.0 °C(Predicted) | | density | 1.696±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | crystalline powder | | color | Lemon tiny fused crystals/chunks | | InChI | InChI=1S/C7H5BrFNO2/c1-4-6(9)2-5(8)3-7(4)10(11)12/h2-3H,1H3 | | InChIKey | QZUIGBPWEFMEEV-UHFFFAOYSA-N | | SMILES | C1(F)=CC(Br)=CC([N+]([O-])=O)=C1C |
| Hazard Codes | Xi,Xn | | Hazard Note | Irritant | | HS Code | 2904990090 |
| | 4-BROMO-2-FLUORO-6-NITROTOLUENE Usage And Synthesis |
| | 4-BROMO-2-FLUORO-6-NITROTOLUENE Preparation Products And Raw materials |
|