|
| 1,3-BIS(2,6-DI-I-PROPYLPHENYL)IMIDAZOL-2-YLIDENE Basic information |
Product Name: | 1,3-BIS(2,6-DI-I-PROPYLPHENYL)IMIDAZOL-2-YLIDENE | Synonyms: | 1,3-BIS(2,6-DI-I-PROPYLPHENYL)IMIDAZOL-2-YLIDENE;1,3-Bis(2,6-di-i-propylphenyl)imidazol-2-ylidene,min.98%;1,3-BIS(2,6-DI-I-PROPYLPHENYL)IMIDAZOL-2-YLIDENE, MIN. 98%;1,3-Bis(2,6-diisopropylphenyl)-1,3-dihydro-2H-imidazol-2-ylidene;1,3-Bis(2,6-diisopropylphenyl)-1H-imidazol-3-ium-2-ide;N,N'-Bis(2,6-diisopropylphenyl)imidazol-2-ylidene;1,3-Bis(2,6-diisopropylphenyl)-1,3-dihydro-2H-iMidazol-2-ylidene 97%;1,3-Bis(2,6-di-i-propylphenyl)imidazol-2-ylidene,98% | CAS: | 244187-81-3 | MF: | C27H36N2** | MW: | 388.59 | EINECS: | | Product Categories: | N-heterocyclic carbene | Mol File: | 244187-81-3.mol | |
| 1,3-BIS(2,6-DI-I-PROPYLPHENYL)IMIDAZOL-2-YLIDENE Chemical Properties |
Melting point | 213-217 °C | storage temp. | -20°C | solubility | soluble in Methanol | form | Powder | color | white to off-white | Sensitive | air sensitive, moisture sensitive | InChI | InChI=1S/C27H36N2/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8/h9-16,18-21H,1-8H3 | InChIKey | VYCIHDBIKGRENI-UHFFFAOYSA-N | SMILES | N1(C=CN(C2C(=CC=CC=2C(C)C)C(C)C)[C]1)C1C(=CC=CC=1C(C)C)C(C)C |^3:16| | CAS DataBase Reference | 244187-81-3 |
Risk Statements | 10 | Safety Statements | 16 | RIDADR | 1325 | WGK Germany | 3 | HS Code | 29332900 |
| 1,3-BIS(2,6-DI-I-PROPYLPHENYL)IMIDAZOL-2-YLIDENE Usage And Synthesis |
Uses | Ligand for Pd complexes for amination reaction of aryl halides; used as C-C bond formation reaction, e.g. Kumada-Tamao-Corriu reaction, Suzuki coupling, and Stille coupling. |
| 1,3-BIS(2,6-DI-I-PROPYLPHENYL)IMIDAZOL-2-YLIDENE Preparation Products And Raw materials |
|