- N-BOC-M-PHENYLENEDIAMINE
-
- $0.00 / 25Kg/Drum
-
2019-11-08
- CAS: 68621-88-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10Tons
- N-BOC-M-PHENYLENEDIAMINE
-
- $0.00 / 25Kg/Drum
-
2019-11-08
- CAS: 68621-88-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10Tons
|
| | N-BOC-M-PHENYLENEDIAMINE Basic information |
| Product Name: | N-BOC-M-PHENYLENEDIAMINE | | Synonyms: | Carbamic acid, (3-aminophenyl)-, 1,1-dimethylethyl ester (9CI);CarbaMic acid, N-(3-aMinophenyl)-, 1,1-diMethylethyl ester;CarbaMic acid, (3-aMinophenyl)-, 1,1-diMethylethyl ester;tert-butyl N-(3-aMinophenyl)carbaMate;3-(tert-Butoxycarbonylamino)aniline, tert-Butyl-3-aminophenylcarbamate;N-Boc-1,3-phenylenediaMine;1,1-Dimethylethyl (3-aminophenyl)carbamate;Boc-m-phenylenediamine | | CAS: | 68621-88-5 | | MF: | C11H16N2O2 | | MW: | 208.26 | | EINECS: | 626-915-0 | | Product Categories: | N-BOC | | Mol File: | 68621-88-5.mol |  |
| | N-BOC-M-PHENYLENEDIAMINE Chemical Properties |
| Melting point | 109-110℃ (dichloromethane ) | | Boiling point | 295.1±23.0 °C(Predicted) | | density | 1.152±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | slightly sol. in Methanol | | form | powder to crystal | | pka | 13.57±0.70(Predicted) | | color | White to Gray to Brown | | InChI | InChI=1S/C11H16N2O2/c1-11(2,3)15-10(14)13-9-6-4-5-8(12)7-9/h4-7H,12H2,1-3H3,(H,13,14) | | InChIKey | IEUIEMIRUXSXCL-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1=CC=CC(N)=C1 | | CAS DataBase Reference | 68621-88-5 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | F | 10-23 | | HS Code | 2924297099 |
| | N-BOC-M-PHENYLENEDIAMINE Usage And Synthesis |
| Uses | N-Boc-m-phenylenediamine (tert-Butyl-3-aminophenylcarbamate) may be used in the preparation of:
- 5,5′-(propane-2,2-diyl)bis(N-(3-aminophenyl)-4-methyl-3-phenyl-1H-pyrrole-2-carboxamide)
- ethyl 4-[{3-[(tert-butoxycarbonyl)amino]phenyl}amino]-2-chloropyrimidine-5-carboxylate
- ethyl 4-(3-(tert-butoxycarbonyl)phenylamino)-2-(methylthio)pyrimidine-5-carboxylate
|
| | N-BOC-M-PHENYLENEDIAMINE Preparation Products And Raw materials |
|