|
|
| | 3′-Deoxy-3′-fluorouridine Basic information | | Appearance |
| Product Name: | 3′-Deoxy-3′-fluorouridine | | Synonyms: | CAINDEXNAME:URIDINE,3'-DEOXY-3'-FLUORO ;3'-Fluoro-3'-deoxyuridine;Uridine, 3'-deoxy-3'-fluoro-;3'-F-3'-dU;3'-fluoro-3'-desoxyuridine;1-(3-Deoxy-3-fluoro-beta-D-ribofuranosyl)uracil;CAINDEXNAME;CAINDEXNAME:URIDINE,3'-DEOXY-3'-FLUORO USP/EP/BP | | CAS: | 57944-13-5 | | MF: | C9H11FN2O5 | | MW: | 246.19 | | EINECS: | | | Product Categories: | | | Mol File: | 57944-13-5.mol |  |
| | 3′-Deoxy-3′-fluorouridine Chemical Properties |
| density | 1.63±0.1 g/cm3(Predicted) | | pka | 9.39±0.10(Predicted) | | InChI | InChI=1S/C9H11FN2O5/c10-6-4(3-13)17-8(7(6)15)12-2-1-5(14)11-9(12)16/h1-2,4,6-8,13,15H,3H2,(H,11,14,16)/t4-,6-,7-,8-/m1/s1 | | InChIKey | FVBOTRDLABQYMI-XVFCMESISA-N | | SMILES | OC[C@H]1O[C@@H](N2C=CC(=O)NC2=O)[C@H](O)[C@@H]1F | | CAS DataBase Reference | 57944-13-5 |
| | 3′-Deoxy-3′-fluorouridine Usage And Synthesis |
| Appearance | Off-white Solid | | Description | 3′-Deoxy-3′-fluorouridine, a compound of utmost significance in the biomedical industry, assumes a pivotal position in the advancement of antiviral pharmaceuticals targeting RNA virus-associated ailments. This exceptional product showcases its robust antiviral efficacy against a multitude of viruses. Through the powerful mechanism of inhibiting viral replication, 3'-Deoxy-3'-fluorouridine emerges as a propitious contender in the ongoing battle against these formidable infectious maladies. | | Uses | 3''-Deoxy-3''-fluorouridine is a uridine derivative and is useful in the study of E. Coli. Also, a reagent in the design of hepatitis C antviral agents. |
| | 3′-Deoxy-3′-fluorouridine Preparation Products And Raw materials |
|