|
| methyl 2,3-dihydroxybenzoate Basic information |
| methyl 2,3-dihydroxybenzoate Chemical Properties |
Melting point | 78.0 to 82.0 °C | Boiling point | 96°C/3.5mmHg(lit.) | density | 1.354±0.06 g/cm3(Predicted) | storage temp. | Inert atmosphere,Room Temperature | form | powder to crystal | pka | 8.98±0.10(Predicted) | color | White to Gray to Red | InChI | InChI=1S/C8H8O4/c1-12-8(11)5-3-2-4-6(9)7(5)10/h2-4,9-10H,1H3 | InChIKey | DOAJWTSNTNAEIY-UHFFFAOYSA-N | SMILES | C(OC)(=O)C1=CC=CC(O)=C1O | LogP | 2.060 (est) | CAS DataBase Reference | 2411-83-8 |
| methyl 2,3-dihydroxybenzoate Usage And Synthesis |
| methyl 2,3-dihydroxybenzoate Preparation Products And Raw materials |
|