|
|
| | Methyl 4,6-dichloronicotinate Basic information |
| Product Name: | Methyl 4,6-dichloronicotinate | | Synonyms: | Methyl 4,6-dichloronicotinate;4,6-Dichloronicotinic acid methyl ester;methyl 4,6-dichloropyridine-3-carboxylate;Methyl 4,6-dichloronicotinate 95+%;3-Pyridinecarboxylic acid, 4,6-dichloro-, Methyl ester;Methyl 4,6-dichloropyridine-3-carboxylate, 2,4-Dichloro-5-(methoxycarbonyl)pyridine;Methyl 4,6-dichloronicotinte;4,6-Dichloro-pyridin-3-carboxylic acid methyl ester | | CAS: | 65973-52-6 | | MF: | C7H5Cl2NO2 | | MW: | 206.03 | | EINECS: | | | Product Categories: | Heterocyclic Compounds;Pyridine;Esters;Pyridines | | Mol File: | 65973-52-6.mol |  |
| | Methyl 4,6-dichloronicotinate Chemical Properties |
| Melting point | 41-43° | | Boiling point | 260.0±35.0 °C(Predicted) | | density | 1.426±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Solid | | pka | -1.24±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C7H5Cl2NO2/c1-12-7(11)4-3-10-6(9)2-5(4)8/h2-3H,1H3 | | InChIKey | JEJMDUMJSZTJTI-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=CC(Cl)=C1C(OC)=O | | CAS DataBase Reference | 65973-52-6 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25 | | HazardClass | IRRITANT | | HS Code | 29339900 |
| | Methyl 4,6-dichloronicotinate Usage And Synthesis |
| | Methyl 4,6-dichloronicotinate Preparation Products And Raw materials |
|