|
| 2-Fluoro-6-methylbenzoic acid Basic information |
| 2-Fluoro-6-methylbenzoic acid Chemical Properties |
Boiling point | 257.7±20.0 °C(Predicted) | density | 1.258±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | pka | 2.96±0.31(Predicted) | form | powder | color | White | InChI | InChI=1S/C8H7FO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) | InChIKey | WELNSIYTQJSNRP-UHFFFAOYSA-N | SMILES | C(O)(=O)C1=C(C)C=CC=C1F | CAS DataBase Reference | 90259-27-1(CAS DataBase Reference) |
Hazard Codes | Xi,Xn | Risk Statements | 22 | Hazard Note | Irritant | HS Code | 2916399090 |
| 2-Fluoro-6-methylbenzoic acid Usage And Synthesis |
| 2-Fluoro-6-methylbenzoic acid Preparation Products And Raw materials |
|