|
| trans-4-(Hydroxymethyl)cyclohexanol Basic information |
Product Name: | trans-4-(Hydroxymethyl)cyclohexanol | Synonyms: | trans-4-(Hydroxymethyl)cyclohexanol;(1r,4r)-4-(hydroxymethyl)cyclohexanol;trans-4-(Hydroxymethyl)cyclohexanol;trans-4-(Hydroxymethyl)cyclohexan-1-ol;TRANS-4-(HYDROXYMETHYL)CYCLOHEXANOL,98.0%(GC);trans-4-(Hydroxymethyl)cyclohexanol>(1r,4r)-4-(hydroxymethyl)cyclohexan-1-ol;Cyclohexanemethanol, 4-hydroxy-, trans- | CAS: | 3685-27-6 | MF: | C7H14O2 | MW: | 130.18 | EINECS: | | Product Categories: | | Mol File: | 3685-27-6.mol | |
| trans-4-(Hydroxymethyl)cyclohexanol Chemical Properties |
Melting point | 104 °C | Boiling point | 262.0±8.0 °C(Predicted) | density | 1.066±0.06 g/cm3(Predicted) | storage temp. | Inert atmosphere,Room Temperature | solubility | soluble in Methanol | form | powder to crystal | pka | 15.05±0.10(Predicted) | color | White to Almost white | InChI | InChI=1S/C7H14O2/c8-5-6-1-3-7(9)4-2-6/h6-9H,1-5H2/t6-,7- | InChIKey | VGRZISGVNOKTQU-LJGSYFOKSA-N | SMILES | [C@@H]1(CO)CC[C@@H](O)CC1 |
| trans-4-(Hydroxymethyl)cyclohexanol Usage And Synthesis |
| trans-4-(Hydroxymethyl)cyclohexanol Preparation Products And Raw materials |
|