|
| 2-(3-AMINO-PHENYL)-BENZOOXAZOL-5-YLAMINE Basic information |
| 2-(3-AMINO-PHENYL)-BENZOOXAZOL-5-YLAMINE Chemical Properties |
Melting point | 231-233°C | Boiling point | 435.2±25.0 °C(Predicted) | density | 1.329 | storage temp. | Keep in dark place,Sealed in dry,2-8°C | solubility | DMSO, Methanol | form | Solid | pka | 7.49±0.10(Predicted) | color | Off-White to Tan | InChI | InChI=1S/C13H11N3O/c14-9-3-1-8(2-4-9)13-16-11-7-10(15)5-6-12(11)17-13/h1-7H,14-15H2 | InChIKey | UMGYJGHIMRFYSP-UHFFFAOYSA-N | SMILES | O1C2=CC=C(N)C=C2N=C1C1=CC=C(N)C=C1 | CAS DataBase Reference | 13676-47-6 |
| 2-(3-AMINO-PHENYL)-BENZOOXAZOL-5-YLAMINE Usage And Synthesis |
Chemical Properties | Off-White to Tan Solid | Uses | 2-(3-Amino-phenyl)-benzooxazol-5-ylamine can be used to prepare high-strength flexible transparent polyimide materials. |
| 2-(3-AMINO-PHENYL)-BENZOOXAZOL-5-YLAMINE Preparation Products And Raw materials |
|