|
| 3,4-Epoxytetrahydrofuran Basic information | Uses |
Product Name: | 3,4-Epoxytetrahydrofuran | Synonyms: | 3,4-EPOXYTETRAHYDROFURAN;3,4-EPOXYTETRAHYDROFURAN 96%;3,4-Epoxytetrahydrofurane;3,4-Epoxytetrahydrofuran, 98 %;3,4-Epoxy-THF;3,4-Diepoxytetrahydrofuran;3,4-Epoxytetrahydrofuran,96%;4-Epoxytetrahydrofuran | CAS: | 285-69-8 | MF: | C4H6O2 | MW: | 86.09 | EINECS: | 206-006-1 | Product Categories: | | Mol File: | 285-69-8.mol | ![3,4-Epoxytetrahydrofuran Structure](CAS/GIF/285-69-8.gif) |
| 3,4-Epoxytetrahydrofuran Chemical Properties |
Boiling point | 44°C 10mm | density | 1.237 | refractive index | 1.445-1.449 | Fp | >38℃ | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | form | Liquid | color | Clear yellow | Water Solubility | MODERATELY SOLUBLE | InChI | InChI=1S/C4H6O2/c1-3-4(6-3)2-5-1/h3-4H,1-2H2 | InChIKey | AIUTZIYTEUMXGG-UHFFFAOYSA-N | SMILES | C12C(O1)COC2 | CAS DataBase Reference | 285-69-8(CAS DataBase Reference) |
| 3,4-Epoxytetrahydrofuran Usage And Synthesis |
Uses | 3,6-Dioxabicyclo[3.1.0]hexane was a reagent used in making various degradable polymers from epoxides using a versatile dinuclear chromium catalyst. | Chemical Properties | clear yellow liquid |
| 3,4-Epoxytetrahydrofuran Preparation Products And Raw materials |
|