|
| 3-(4-methylpiperazin-1-yl)propanoic acid Basic information |
Product Name: | 3-(4-methylpiperazin-1-yl)propanoic acid | Synonyms: | RARECHEM AL BO 2379;TIMTEC-BB SBB010546;3-(4-METHYL-PIPERAZIN-1-YL)-PROPIONIC ACID >98%;4-Methylpiperazine-4-propanoic acid;3-(4-methylpiperazin-1-yl)propanoic acid(SALTDATA: FREE);3-(4-Methyl-1-piperazinyl)propanoic Acid;1-piperazinepropanoic acid, 4-methyl-;BUTTPARK 82\11-37 | CAS: | 55480-45-0 | MF: | C8H16N2O2 | MW: | 172.22 | EINECS: | | Product Categories: | piperazines;PIPERIDINE | Mol File: | 55480-45-0.mol | |
| 3-(4-methylpiperazin-1-yl)propanoic acid Chemical Properties |
Boiling point | 305.5±27.0 °C(Predicted) | density | 1.095±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Store in freezer, under -20°C | pka | 4.55±0.10(Predicted) | InChI | InChI=1S/C8H16N2O2/c1-9-4-6-10(7-5-9)3-2-8(11)12/h2-7H2,1H3,(H,11,12) | InChIKey | JSHLMMUXJIDENZ-UHFFFAOYSA-N | SMILES | N1(CCC(O)=O)CCN(C)CC1 |
| 3-(4-methylpiperazin-1-yl)propanoic acid Usage And Synthesis |
Synthesis | Ethyl 3-(4-methylpiperazin-1-yl)propanoate could be used as a starting material to synthesize 3-(4-methylpiperazin-1-yl)propanoic acid via hydrolysis reaction.
|
| 3-(4-methylpiperazin-1-yl)propanoic acid Preparation Products And Raw materials |
|