|
| (R)-(+)-3-(Benzyloxycarbonyl)-4-oxazolidinecarboxylic acid Basic information |
| (R)-(+)-3-(Benzyloxycarbonyl)-4-oxazolidinecarboxylic acid Chemical Properties |
Melting point | 70-74 °C(lit.) | Boiling point | 454.8±45.0 °C(Predicted) | alpha | +92°(20℃, c=1, CHCl3) | density | 1.385 | pka | 3.51±0.20(Predicted) | optical activity | [α]20/D +92°, c = 1 in chloroform | InChI | InChI=1S/C12H13NO5/c14-11(15)10-7-17-8-13(10)12(16)18-6-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,15)/t10-/m1/s1 | InChIKey | XRRRGBIMHQARMF-SNVBAGLBSA-N | SMILES | O1C[C@H](C(O)=O)N(C(OCC2=CC=CC=C2)=O)C1 | CAS DataBase Reference | 97534-84-4 |
WGK Germany | 3 | HS Code | 29349990 |
| (R)-(+)-3-(Benzyloxycarbonyl)-4-oxazolidinecarboxylic acid Usage And Synthesis |
Chemical Properties | White powder | Uses | Useful chiral synthon (derived from serine) for the asymmetric synthesis of a variety of nitrogen-containing targets. |
| (R)-(+)-3-(Benzyloxycarbonyl)-4-oxazolidinecarboxylic acid Preparation Products And Raw materials |
|