|
|
| | 3,3'-(Oxybis(methylene))bis(3-ethyloxetane) Basic information |
| Product Name: | 3,3'-(Oxybis(methylene))bis(3-ethyloxetane) | | Synonyms: | 3-Ethyl-3[[(3-ethyloxetane-3-yl)methoxy]methyl]oxetane;3,3'-(oxydiMethanediyl)bis(3-ethyloxetane);3-Ethyl-3;Aron Oxetane OXT 221;Di[1-ethyl-(3-oxetanyl)methyl]ether;Oxetane,3,3'-(oxydimethylene)bis[3-ethyl- (8CI);Oxetane,3,3'-[oxybis(methylene)]bis[3-ethyl-;OXT 221 | | CAS: | 18934-00-4 | | MF: | C12H22O3 | | MW: | 214.3 | | EINECS: | 620-240-5 | | Product Categories: | | | Mol File: | 18934-00-4.mol |  |
| | 3,3'-(Oxybis(methylene))bis(3-ethyloxetane) Chemical Properties |
| Boiling point | 275℃ | | density | 0.992 | | Fp | 91℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | InChI | InChI=1S/C12H22O3/c1-3-11(5-13-6-11)9-15-10-12(4-2)7-14-8-12/h3-10H2,1-2H3 | | InChIKey | FNYWFRSQRHGKJT-UHFFFAOYSA-N | | SMILES | O(CC1(CC)COC1)CC1(CC)COC1 | | EPA Substance Registry System | Oxetane, 3,3'-[oxybis(methylene)]bis[3-ethyl- (18934-00-4) |
| | 3,3'-(Oxybis(methylene))bis(3-ethyloxetane) Usage And Synthesis |
| Chemical Properties | Colorless or light yellow transparent liquid | | Uses | Mainly for the synthesis of UV polymerization, coatings, and resins. UV-curable monomer material can be used in UV inks, coatings, and UV adhesives; do the raw material of other UV-curable monomers, the nature and function equivalent to OXT-221. |
| | 3,3'-(Oxybis(methylene))bis(3-ethyloxetane) Preparation Products And Raw materials |
|