|
|
| Product Name: | tBuBrettPhos | | Synonyms: | 2-(Di-tert-butylphosphino)-2',4',6'-triisopropyl-3,6-diMethoxybiphenyl;2-Di-t-butylphosphino-2',4',6'-tri-i-propyl-3,6-diMethoxy-1,1'-biphenyl, 98% (t-BuBrettPhos);tBuBrettPhos 97%;tertButylBrettPhos;tert-ButylBrettPhos;2-Di-t-butylphosphino-2',4',6'-tri-i-propyl-3,6-dimethoxy-1,1'-biphenyl, (t-BuBrettPhos);2-(Di-t-butylphosphino)-3,6-dimethoxy-2'-4'-6'-tri-i-propyl-1,1'-biphenyl, min. 98% t-butylBrettPhos;T-BUBRETTPHOS, [3,6-DIMETHOXY-2′,4′,6′-TRIS(1-METHYLETHYL) [1,1′-BIPHENYL]-2-YL]BIS(1,1-DIMETHYLETHYL)PHOSPHINE | | CAS: | 1160861-53-9 | | MF: | C31H49O2P | | MW: | 484.69 | | EINECS: | | | Product Categories: | Achiral Phosphine;Aryl Phosphine;Buchwald Ligands Series;Buchwald Ligands&Precatalysts | | Mol File: | 1160861-53-9.mol |  |
| | tBuBrettPhos Chemical Properties |
| Melting point | 166-170°C | | Boiling point | 534.9±50.0 °C(Predicted) | | form | crystal | | color | white | | InChI | InChI=1S/C31H49O2P/c1-19(2)22-17-23(20(3)4)27(24(18-22)21(5)6)28-25(32-13)15-16-26(33-14)29(28)34(30(7,8)9)31(10,11)12/h15-21H,1-14H3 | | InChIKey | REWLCYPYZCHYSS-UHFFFAOYSA-N | | SMILES | P(C1=C(OC)C=CC(OC)=C1C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C)(C(C)(C)C)C(C)(C)C |
| WGK Germany | 3 | | HS Code | 2931.90.6000 |
| | tBuBrettPhos Usage And Synthesis |
| Reaction |
- Ligand used in the Pd-catalyzed conversion of aryl and vinyl triflates to bromides and chlorides.
- Ligand used in the Pd-catalyzed O-arylation of ethyl acetohydroximates.
- Ligand used in the Pd-catalyzed conversion of aryl chlorides, triflates, and nonaflates to nitroaromatics.
- Ligand used in the Pd-catalyzed cross-coupling of amides and aryl mesylates.
| | Uses | Buchwald Phosphine Ligands for chemical Synthesis | | General Description | tBuBrettPhos is a dialkylbiaryl phosphine ligand developed by the Buchwald group. It promotes cross-coupling reactions more efficiently and exhibits improved reactivity compared to other catalytic systems. | | reaction suitability | reaction type: Cross Couplings
reagent type: ligand
reaction type: Arylations
reagent type: ligand
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reagent type: ligand
reaction type: C-X Bond Formation
reagent type: ligand
reaction type: Fluorinations |
| | tBuBrettPhos Preparation Products And Raw materials |
|