- Silybin
-
- $0.00 / 25kg
-
2024-03-28
- CAS:802918-57-6
- Min. Order: 25kg
- Purity: 30% 50%(HPLC) 80%(UV)
- Supply Ability: Inquiry
|
| | Silybin Basic information |
| Product Name: | Silybin | | Synonyms: | Silybin A,B (Mixture);Silybin (Mixture of Diastereomers);4H-1-Benzopyran-4-one, 2-[2,3-dihydro-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-1,4-benzodioxin-6-yl]-2,3-dihydro-3,5,7-trihydroxy-, (2R,3R)-;(2R,3R)-3,5,7-Trihydroxy-2-(3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydrobenzo[b][1,4]dioxin-6-yl)chroman-4-one | | CAS: | 802918-57-6 | | MF: | C25H22O10 | | MW: | 482.44 | | EINECS: | 806-403-5 | | Product Categories: | Aromatics;Chiral Reagents;Intermediates & Fine Chemicals;Isotope Labelled Compounds;Pharmaceuticals | | Mol File: | 802918-57-6.mol |  |
| | Silybin Chemical Properties |
| Melting point | 152-153°C | | Boiling point | 793.0±60.0 °C(Predicted) | | density | 1.527±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Acetone (Sparingly, Sonicated, Heated), DMSO (Slightly), Methanol (Slightly, Heated) | | pka | 7.39±0.60(Predicted) | | form | Solid | | color | Pale Yellow to Beige | | InChIKey | SEBFKMXJBCUCAI-DBMPWETRSA-N | | SMILES | [C@H]1(C2=CC=C3OC(CO)C(C4=CC=C(O)C(OC)=C4)OC3=C2)OC2=CC(O)=CC(O)=C2C(=O)[C@@H]1O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | DJ2981770 |
| | Silybin Usage And Synthesis |
| Chemical Properties | Beige Solid | | Uses | Reference standard in the analysis of herbal medicinal products. | | Uses | Hepatoprotectant. In nature, the flavonolignan Silybin occurs as a mixture of two diastereomers, Silybin A and Silybin B. | | General Description | Produced and qualified by HWI pharma services GmbH.
Exact content by quantitative NMR can be found on the certificate. |
| | Silybin Preparation Products And Raw materials |
|