- 3-Aminodibenzothiophene
-
- $200.00 / 1KG
-
2024-01-02
- CAS:25288-76-0
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
- 3-Aminodibenzothiophene
-
- $0.00 / 1kg
-
2023-10-26
- CAS:25288-76-0
- Min. Order: 1kg
- Purity: 99.9%
- Supply Ability: 30000 Kg
|
| | dibenzo[b,d]thiophen-3-aMine Basic information |
| Product Name: | dibenzo[b,d]thiophen-3-aMine | | Synonyms: | dibenzo[b,d]thiophen-3-aMine;3-Aminodibenzothiophene;3-Dibenzothiophenamine;dibenzothiophen-3-amine;Dibenzothiophen-3-ylamin;dibenzo[b,d]thiophen-3-aMine ISO 9001：2015 REACH;ibenzo[b,d]thiophen-3-aMine | | CAS: | 25288-76-0 | | MF: | C12H9NS | | MW: | 199.27 | | EINECS: | | | Product Categories: | | | Mol File: | 25288-76-0.mol | ![dibenzo[b,d]thiophen-3-aMine Structure](CAS/GIF/25288-76-0.gif) |
| | dibenzo[b,d]thiophen-3-aMine Chemical Properties |
| Melting point | 121-123℃ | | Boiling point | 413.2±18.0 °C(Predicted) | | density | 1.333 | | pka | 4.03±0.30(Predicted) | | InChI | InChI=1S/C12H9NS/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7H,13H2 | | InChIKey | HSIYJKUTMUOWPE-UHFFFAOYSA-N | | SMILES | C12=CC(N)=CC=C1C1=CC=CC=C1S2 |
| | dibenzo[b,d]thiophen-3-aMine Usage And Synthesis |
| Uses | Dibenzo[b,d]thiophen-3-amine can be used for the synthesis of the isomeric indobenzo[b]thiophene via the Fischer reaction. It can also be used to prepare organic electroluminescent element materials. | | Preparation | The dibenzo[b,d]thiophen-3-amine molecule was synthesized using a three step process starting with the reaction of 1,2-dimethoxyethane (1) with aniline (2). This was followed by oxidation with sodium dichromate (NaCrO), which resulted in the formation of dibenzothiophene (3). Finally, this compound was reacted with ammonia to produce the desired product |
| | dibenzo[b,d]thiophen-3-aMine Preparation Products And Raw materials |
|