| Company Name: |
Suzhouhongxiong Gold
|
| Tel: |
18051745768 18051745768 |
| Email: |
Suzhouhongxiong@163.com |
| Products Intro: |
Product Name:5(6)-Nitrofluorescein
CAS:78512-32-0
Purity:98 Package:1kg
|
| Company Name: |
BeiJing Hwrk Chemicals Limted
|
| Tel: |
0757-86329057 18934348241 |
| Email: |
sales4.gd@hwrkchemical.com |
| Products Intro: |
Product Name:5(6)-Nitrofluorescein
CAS:78512-32-0
Purity:95.00% Package:5g
|
|
| | 5(6)-Nitrofluorescein Basic information |
| Product Name: | 5(6)-Nitrofluorescein | | Synonyms: | 5(6)-Nitrofluorescein;3',6'-Dihydroxy-5(or 6)-nitro-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one;3',6'-Dihydroxy-5(or 6)-nitro-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one | | CAS: | 78512-32-0 | | MF: | C20H11NO7 | | MW: | 377.30384 | | EINECS: | | | Product Categories: | | | Mol File: | 78512-32-0.mol |  |
| | 5(6)-Nitrofluorescein Chemical Properties |
| storage temp. | 2-8°C | | InChI | InChI=1S/C20H11NO7/c22-11-2-5-15-17(8-11)27-18-9-12(23)3-6-16(18)20(15)14-4-1-10(21(25)26)7-13(14)19(24)28-20/h1-9,22-23H | | InChIKey | UACQOMKZFGNRBL-UHFFFAOYSA-N | | SMILES | O1C2(C3=C(C=C(O)C=C3)OC3=C2C=CC(O)=C3)C2=CC=C([N+]([O-])=O)C=C2C1=O |
| | 5(6)-Nitrofluorescein Usage And Synthesis |
| Uses |
5(6)-Nitrofluorescein is the mixture of 5- and 6-nitrofluoresceine isomers. This compound is a useful compound that could be used to synthesize fluorescein 5-isothiocyanate.
| | Synthesis | A process for the preparation of a mixture (5(6)-Nitrofluorescein) of 3′,6′-dihydroxy-6-nitrospiro[2-benzofuran-3,9′-xanthene]-1-one and 3′,6′-dihydroxy-5-nitrospiro[2-benzofuran-3,9′- xanthene]-1-one comprising the steps of (a) reacting 4-nitrophthalic acid or 4-nitrophthalic anhydride with benzene-1,3-diol in methanesulphonic acid; (b) quenching the reaction in step (a) with a solvent to precipitate product; (c) isolating the precipitate; (d) heating the precipitate in water in order to hydrolyse any methansulphonic acid ester present.
|
| | 5(6)-Nitrofluorescein Preparation Products And Raw materials |
|