1,4-Dideoxy-1,4-epithio-D-ribitol manufacturers
|
| 1,4-Dideoxy-1,4-epithio-D-ribitol Basic information |
| 1,4-Dideoxy-1,4-epithio-D-ribitol Chemical Properties |
Boiling point | 327.4±42.0 °C(Predicted) | density | 1.490±0.06 g/cm3(Predicted) | pka | 13.65±0.60(Predicted) | InChI | InChI=1S/C5H10O3S/c6-1-4-5(8)3(7)2-9-4/h3-8H,1-2H2/t3-,4+,5-/m0/s1 | InChIKey | VLVSFIRYIVAVKW-LMVFSUKVSA-N | SMILES | C1S[C@H](CO)[C@@H](O)[C@H]1O |
| 1,4-Dideoxy-1,4-epithio-D-ribitol Usage And Synthesis |
Description | 1,4-Dideoxy-1,4-epithio-D-ribitol ((2R,3S,4R)-2-(hydroxymethyl)thiolane-3,4-diol), an indispensable compound in the field of biomedicine, is known for its significant role in combating viral infections. Primarily utilized as an anti-viral agent, this marvelously intricate molecule exhibits remarkable efficacy in hindering the replication and dissemination of notorious viruses, including herpes simplex virus and Epstein-Barr virus. By impeding their proliferation, it effectively contributes to the amelioration and prophylaxis of afflictions closely associated with these pathogens. |
| 1,4-Dideoxy-1,4-epithio-D-ribitol Preparation Products And Raw materials |
Raw materials | D-Ribitol, 1,4-dideoxy-1,4-epithio-2,3,5-tris-O-(phenylmethyl)--->1,4-dideoxy-1,4-epithio-2,3,5-tris-O-[(4-methoxyphenyl)methyl]-D-Ribitol-->1,4-Anhydro-2,3-O-isopropylidene-4-thio-D-ribitol |
|