|
|
| | Methyl 4-ketocyclohexanecarboxylate Basic information |
| | Methyl 4-ketocyclohexanecarboxylate Chemical Properties |
| Boiling point | 96-97 °C(Press: 8.0 Torr) | | density | 1.11g/ml | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Chloroform, Methanol | | form | Oil | | color | Clear Colourless | | InChI | InChI=1S/C8H12O3/c1-11-8(10)6-2-4-7(9)5-3-6/h6H,2-5H2,1H3 | | InChIKey | BLYKGTCYDJZLFB-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)CCC(=O)CC1 |
| | Methyl 4-ketocyclohexanecarboxylate Usage And Synthesis |
| Uses | Methyl 4-Oxocyclohexanecarboxylate is an intermediate for preparation of imidazobenzazepine derivatives as dual H1/5-HT2A antagonists for treatment of sleep disorders. | | Synthesis |
The 4-hydroxy methyl ester (4.147 g; 26.21 mmol) was dissolved in 150 mL DCM, and pyridinium chlorochromate (PCC) (8.476 g; 39.32 mmol) was added. The reaction mixture was allowed to stir at room temperature overnight. The reaction mixture was diluted with ether and decanted. Solvents were removed, and the residue was purified by flash column chromatography using 25 percent EtOAc in a hexane mixture as eluent. The product Methyl 4-ketocyclohexanecarboxylate was obtained as a colorless oil.
|
| | Methyl 4-ketocyclohexanecarboxylate Preparation Products And Raw materials |
|