|
|
| | 4-Bromo-3-fluorobenzonitrile Basic information |
| | 4-Bromo-3-fluorobenzonitrile Chemical Properties |
| Melting point | 54-58 C | | Boiling point | 230.1±20.0 °C(Predicted) | | density | 1.69±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C7H3BrFN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H | | InChIKey | QBKXYSXQKRNVRQ-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(Br)C(F)=C1 | | CAS DataBase Reference | 133059-44-6(CAS DataBase Reference) |
| | 4-Bromo-3-fluorobenzonitrile Usage And Synthesis |
| Chemical Properties | White to light brown solid | | Uses | 4-Bromo-3-fluorobenzonitrile is a fluorobenzonitrile that is used in the preparation of ethylene. This chemical can also be used in the synthesis of pharmaceuticals and dyes. 4-Bromo-3-fluorobenzonitrile has been shown to have antimutagenicity and DNA repair abilities, which are due to its ability to inhibit carcinogen metabolism by binding to the enzyme cytochrome P450 2E1. 4-Bromo-3-fluorobenzonitrile also prevents cross linking of collagen by reacting with amino groups on lysine residues, which leads to a decrease in cardiac toxicity. |
| | 4-Bromo-3-fluorobenzonitrile Preparation Products And Raw materials |
|