DBCO-sulfo-NHS ester manufacturers
|
| | DBCO-sulfo-NHS ester Basic information |
| Product Name: | DBCO-sulfo-NHS ester | | Synonyms: | DBCO-sulfo-NHS ester;DBCO-sulfo-SE;Dibenzocyclooctyne-sulfo-N-hydroxysuccinimidyl ester;DBCO-sulfo-NHS ester,DBCO-sulfo-SE;DBCO-Sulfo-NHS ester sodium;DBCO-C6-Sulfo-NHS ester;DBCO-Sulfo-NHS Ester (CCT-A124) | | CAS: | 1400191-52-7 | | MF: | C25H23N2NaO8S | | MW: | 534.51 | | EINECS: | | | Product Categories: | | | Mol File: | 1400191-52-7.mol |  |
| | DBCO-sulfo-NHS ester Chemical Properties |
| Melting point | 240-260 °C | | storage temp. | -20°C | | form | Solid | | color | Off-white to yellow | | InChIKey | NSZPURPXEZOXPC-UHFFFAOYSA-N | | SMILES | C(N1CC2=CC=CC=C2C#CC2=CC=CC=C12)(=O)CCCCC(=O)ON1C(CC(S(O)(=O)=O)C1=O)=O.[NaH] |
| | DBCO-sulfo-NHS ester Usage And Synthesis |
| Description | DBCO-Sulfo-NHS ester is a water-soluble sulfocated reagent containing DBCO moiety. It can be used for simple and efficient labeling of antibodies, proteins and any other primary amine-bearing macromolecules with DBCO moiety in 100% aqueous buffers. DBCO is commonly used for copper-free Click Chemistry reactions. | | Uses | Dibenzocyclooctyne-sulfo-N-hydroxysuccinimidyl ester may be used for the covalent modification of nano-sized metal-organic frameworks (NMOFs) with nucleic acids via click chemistry during the synthesis stimuli-responsive DNA-gated NMOFs. These NMOFs can act as carriers of a fluorescent agent or anticancer drug, making them highly useful in targeted drug release system. | | reaction suitability | reaction type: click chemistry
reagent type: linker | | IC 50 | Cleavable Linker |
| | DBCO-sulfo-NHS ester Preparation Products And Raw materials |
|