|
|
| | 1,1-Cyclobutanedicarboxylic acid Basic information | | Uses |
| Product Name: | 1,1-Cyclobutanedicarboxylic acid | | Synonyms: | Caboplatin IMpurity B (Cyclobutane-1,1-dicarboxylic acid);1,1-Dicarboxylic acid cyclobutane;1,1-cyclobutanetwo forMic acid;1,1-Cyclobutanedicarboxylic acid, 99% 25GR;1,1-Cyclobutanedicarboxylic acid, 99% 5GR;1,1-Cyclobutanedicar;Cyclobutane-1,1-dicarboxylic acid 99%;1,1-Dicarboxycyclobutane | | CAS: | 5445-51-2 | | MF: | C6H8O4 | | MW: | 144.13 | | EINECS: | 226-651-2 | | Product Categories: | Carboxylic Acids;Organic acids;Cyclobutanes & Cyclobutenes;Simple 4-Membered Ring Compounds;Carboxylic Acids;Ring Systems;Cycloalkanes;C6;Carbonyl Compounds;pharmaceutical;bc0001 | | Mol File: | 5445-51-2.mol |  |
| | 1,1-Cyclobutanedicarboxylic acid Chemical Properties |
| Melting point | 158 °C(lit.) | | Boiling point | 222.71°C (rough estimate) | | density | 1.3217 (rough estimate) | | refractive index | 1.5800 (estimate) | | storage temp. | Store below +30°C. | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Fine Crystalline Powder | | pka | pK1:3.13 ;pK2:5.88 (25°C) | | color | White | | BRN | 2046031 | | InChI | InChI=1S/C6H8O4/c7-4(8)6(5(9)10)2-1-3-6/h1-3H2,(H,7,8)(H,9,10) | | InChIKey | CCQPAEQGAVNNIA-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)(C(O)=O)CCC1 | | CAS DataBase Reference | 5445-51-2(CAS DataBase Reference) | | NIST Chemistry Reference | 1,1-Cyclobutanedicarboxylic acid(5445-51-2) | | EPA Substance Registry System | 1,1-Cyclobutanedicarboxylic acid (5445-51-2) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-28A | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive | | TSCA | T | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29172000 |
| | 1,1-Cyclobutanedicarboxylic acid Usage And Synthesis |
| Uses |
1,1-Cyclobutanedicarboxylic Acid(5445-51-2) is used in the design, studies and structural model of antitumor dicycloplatin a clinical cancer drug. Hydrolysis mechanism of second-generation anticancer drug carboplatin.
| | Chemical Properties | white fine crystalline powder | | Definition | ChEBI: Cyclobutane-1,1-dicarboxylic acid is a cyclobutanedicarboxylic acid. It is a conjugate acid of a cyclobutane-1,1-dicarboxylate(1-). | | Application | 1,1-Cyclobutanedicarboxylic acid can be used as:
A reactant to synthesize lithium coordination polymer by treating with lithium carbonate.
A ligand to prepare various lanthanide metal-organic frameworks (LnMOFs) via a solvothermal method. Eu+3 based MOF is applicable as a selective chemical sensor for detecting CH3OH due to its high luminescence quantum yield.
It can also be used as a starting material in the synthesis of carboplatin (cis-diammine(1,1-cyclobutanedicarboxyl-ate)platinum(II)). |
| | 1,1-Cyclobutanedicarboxylic acid Preparation Products And Raw materials |
|