|
|
| | 1,3,5-Triazine-2,4,6-(1H,3H,5H)-trithione trisodium salt Basic information |
| Product Name: | 1,3,5-Triazine-2,4,6-(1H,3H,5H)-trithione trisodium salt | | Synonyms: | Trithiocyanuric acid trisodium salt hydrate,1,3,5-Triazine-2,4,6-trithiol trisodium salt hydrate;Trithiocyanuric acid trisodiuM salt hydrate 98%;1,3,5-Triazine-2,4,6-(1H,3H,5H)-trithione trisodiuM salt
SynonyMs: TriMercapto-s-triazine;Heavy Metal capture agent TMT (3 Mercapto triazine sodiuM);TMTH-15 waste water treatMent agent;1,3,5-Triazine-2,4,6-trithiol trisodium salt, approx. 15% solution in water;Trithiocyanuric acid TrisodillM salt;1,3,5-Triazine-2,4,6(1H,3H,5H)-trithione,sodiuM salt (1:3) | | CAS: | 17766-26-6 | | MF: | C3H4N3NaS3 | | MW: | 201.26 | | EINECS: | 241-749-5 | | Product Categories: | Water Treatment;Heterocyclic Compounds;chemical additive | | Mol File: | 17766-26-6.mol |  |
| | 1,3,5-Triazine-2,4,6-(1H,3H,5H)-trithione trisodium salt Chemical Properties |
| Melting point | 82-84 °C(lit.) | | density | 1.583[at 20℃] | | vapor pressure | 0Pa at 25℃ | | form | Liquid | | color | light yellow | | Water Solubility | 346.15g/L at 22℃ | | InChI | InChI=1S/C3H3N3S3.Na.H/c7-1-4-2(8)6-3(9)5-1;;/h(H3,4,5,6,7,8,9);; | | InChIKey | NYVOYAFUSJONHU-UHFFFAOYSA-K | | SMILES | S=C1NC(=S)NC(=S)N1.[NaH] | | LogP | 0.01 at 25℃ | | EPA Substance Registry System | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trithione, trisodium salt (17766-26-6) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26-36 | | RIDADR | UN 3267 8 / PGI | | WGK Germany | 2 | | HS Code | 29336990 | | Toxicity | rat,LD50,skin,> 2gm/kg (2000mg/kg),National Technical Information Service. Vol. OTS0556041, |
| | 1,3,5-Triazine-2,4,6-(1H,3H,5H)-trithione trisodium salt Usage And Synthesis |
| Uses | Heavy metal removal,Heavy metal capture Adsorbent agent | | General Description | Trithiocyanuric acid trisodium salt hydrate is the hydrated trisodium salt of trithiocyanuric acid (1,3,5-triazine-2,4,6(1H,3H,5H)-trithione). 2,4,6-trimercapto-s-triazine, trisodium salt commonly referred as TMT-55, is employed for the removal of heavy metals from polluted waters. | | Hazard | Moderately toxic by skin contact. | | Flammability and Explosibility | Non flammable |
| | 1,3,5-Triazine-2,4,6-(1H,3H,5H)-trithione trisodium salt Preparation Products And Raw materials |
|