|
|
| | 3-Pyridylacetic acid hydrochloride Basic information |
| | 3-Pyridylacetic acid hydrochloride Chemical Properties |
| Melting point | 161-163 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Crystalline Powder, Crystals and/or Chunks | | color | White to light yellow or beige | | Merck | 14,7971 | | BRN | 3696630 | | Stability: | Hygroscopic | | InChI | InChI=1S/C7H7NO2.ClH/c9-7(10)4-6-2-1-3-8-5-6;/h1-3,5H,4H2,(H,9,10);1H | | InChIKey | XVCCOEWNFXXUEV-UHFFFAOYSA-N | | SMILES | C(C1=CN=CC=C1)C(=O)O.Cl | | CAS DataBase Reference | 6419-36-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10 | | HazardClass | IRRITANT | | HS Code | 29333990 |
| | 3-Pyridylacetic acid hydrochloride Usage And Synthesis |
| Description | 3-Pyridineacetic acid hydrochloride is a higher homologue of nicotinic acid, a breakdown product of nicotine (and other tobacco alkaloids). | | Chemical Properties | white to beige crystalline powder | | Uses | These Secondary Standards are qualified as Certified Reference Materials. These are suitable for use in several analytical applications including but not limited to pharma release testing, pharma method development for qualitative and quantitative analyses, food and beverage quality control testing, and other calibration requirements. | | Uses | 3-Pyridylacetic Acid is a metabolite of Nicotine (N412420). 3-Pyridylacetic Acid is an antilipemic. | | General Description | Risedronate Impurity D is an impurity of risedronate, which is a new generation pyridinyl bisphosphonate, effectively used in the treatment of Paget′s disease of bone. It is also used for the treatment of skeletal disorders since it inhibits osteoclast-mediated bone resorption and modulates bone metabolism. |
| | 3-Pyridylacetic acid hydrochloride Preparation Products And Raw materials |
|