|
|
| | 5-Bromo-4-cyclopropyl-6-methoxypyrimidine Basic information |
| | 5-Bromo-4-cyclopropyl-6-methoxypyrimidine Chemical Properties |
| Boiling point | 289.3±40.0 °C(Predicted) | | density | 1.590±0.06 g/cm3(Predicted) | | pka | 2.13±0.28(Predicted) | | InChI | InChI=1S/C8H9BrN2O/c1-12-8-6(9)7(5-2-3-5)10-4-11-8/h4-5H,2-3H2,1H3 | | InChIKey | FHEYKQYHQQAZBJ-UHFFFAOYSA-N | | SMILES | C1=NC(OC)=C(Br)C(C2CC2)=N1 |
| | 5-Bromo-4-cyclopropyl-6-methoxypyrimidine Usage And Synthesis |
| Synthesis | To a solution of 4-cyclopropyl-6-methoxypyrimidine (1.6 g, 10.7 mmol) in EtOH (10 mL) was added Bn (1.87 g, 11.7 mmol) at -20 °C. The resulting mixture was slowly warmed to room temperature and stirred at the same temperature for 16 h. Solvent was removed under reduced pressure and the residue dissolved in EtOAc and washed with saturated Na2C03, water and brine. The organic layer was dried over Na2SO4 and concentrated to give 5-bromo-4-cyclopropyl-6-methoxypyrimidine (2.3 g).
 |
| | 5-Bromo-4-cyclopropyl-6-methoxypyrimidine Preparation Products And Raw materials |
|