|
| Sodium ethanesulfinate Basic information |
Product Name: | Sodium ethanesulfinate | Synonyms: | ETHANE SULFINIC ACID SODIUM SALT;Nsc371084;Sodium Ethanesulfinate;sodium 1-sulfinatoethane;Ethanesulfinic acid, sodium salt (8CI,9CI);ethanesulfinate | CAS: | 20035-08-9 | MF: | C2H5NaO2S | MW: | 116.11 | EINECS: | | Product Categories: | | Mol File: | 20035-08-9.mol | |
| Sodium ethanesulfinate Chemical Properties |
Melting point | 292°C | density | 1.372 | storage temp. | Inert atmosphere,Room Temperature | InChI | InChI=1S/C2H6O2S.Na/c1-2-5(3)4;/h2H2,1H3,(H,3,4);/q;+1/p-1 | InChIKey | UWIVVFQECQYHOB-UHFFFAOYSA-M | SMILES | S(CC)(=O)[O-].[Na+] |
| Sodium ethanesulfinate Usage And Synthesis |
| Sodium ethanesulfinate Preparation Products And Raw materials |
|