|
|
| | N-Acetic acid-indole-3-carboxaldehyde Basic information |
| | N-Acetic acid-indole-3-carboxaldehyde Chemical Properties |
| Melting point | 197-200 °C(lit.) | | Boiling point | 458.5±25.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | pka | 4.15±0.10(Predicted) | | Sensitive | Air Sensitive | | BRN | 5431204 | | InChI | InChI=1S/C11H9NO3/c13-7-8-5-12(6-11(14)15)10-4-2-1-3-9(8)10/h1-5,7H,6H2,(H,14,15) | | InChIKey | ZUUGBTJTGRTIFK-UHFFFAOYSA-N | | SMILES | N1(CC(O)=O)C2=C(C=CC=C2)C(C=O)=C1 | | CAS DataBase Reference | 138423-98-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8-10-23 | | HazardClass | IRRITANT | | HS Code | 29339900 |
| | N-Acetic acid-indole-3-carboxaldehyde Usage And Synthesis |
| Chemical Properties | Solid | | Uses | Handle to synthesize an indolecarboxaldehyde resin by coupling to an amino-resin. Amines and derivatives can be immobilized by reductive amination of this aldehyde resin. Mild cleavage with 50% TFA |
| | N-Acetic acid-indole-3-carboxaldehyde Preparation Products And Raw materials |
|