| Company Name: |
Xuzhou Hongrui Technology Co., Ltd Gold
|
| Tel: |
18668931216 |
| Email: |
542271483@qq.com |
| Products Intro: |
Product Name:3-(3-bromo-2-methyl-6-(methylsulfonyl)phenyl)-4,5-dihydroisoxazole
CAS:247922-29-8
Purity:98% Package:1g;100mg
|
| Company Name: |
Hongdebiotech
|
| Tel: |
17712623939 |
| Email: |
sales@hongdesciences.com |
| Products Intro: |
Product Name:3-(3-bromo-2-methyl-6-(methylsulfonyl)phenyl)-4,5-dihydroisoxazole
CAS:247922-29-8
Purity:99% HPLC Package:5KG;1KG
|
| Company Name: |
Beijing konoscience Technology Ltd.
|
| Tel: |
010-56034419 13426091577 |
| Email: |
ws@hibio-e.com |
| Products Intro: |
Product Name:3-(3-bromo-2-methyl-6-(methylsulfonyl)phenyl)-4,5-dihydroisoxazole
CAS:247922-29-8
Purity:98 Package:1G/RMB 56000;500MG1000MG
|
| Company Name: |
Shandong Dexin Fine Chemical Co. LTD
|
| Tel: |
13475558980 13475558980 |
| Email: |
644535754@qq.com |
| Products Intro: |
Product Name:Isoxazole, 3-[3-bromo-2-methyl-6-(methylsulfonyl)phenyl]-4,5-dihydro-
CAS:247922-29-8
Purity:98% Package:25kg
|
|
| | 3-(3-Bromo-2-methyl-6-(methylsulfonyl)phenyl)-4,5-dihydroisoxazole Basic information |
| | 3-(3-Bromo-2-methyl-6-(methylsulfonyl)phenyl)-4,5-dihydroisoxazole Chemical Properties |
| InChI | InChI=1S/C11H12BrNO3S/c1-7-8(12)3-4-10(17(2,14)15)11(7)9-5-6-16-13-9/h3-4H,5-6H2,1-2H3 | | InChIKey | NOAIQLLBVFANQS-UHFFFAOYSA-N | | SMILES | O1CCC(C2=C(S(C)(=O)=O)C=CC(Br)=C2C)=N1 |
| | 3-(3-Bromo-2-methyl-6-(methylsulfonyl)phenyl)-4,5-dihydroisoxazole Usage And Synthesis |
| Uses | 3-(3-Bromo-2-methyl-6-(methylsulfonyl)phenyl)-4,5-dihydroisoxazole is a valuable organic reagent that could be used to synthesize Topramezone.
|
| | 3-(3-Bromo-2-methyl-6-(methylsulfonyl)phenyl)-4,5-dihydroisoxazole Preparation Products And Raw materials |
|