Related articles - What is 4-Isopropyl-3-methylphenol?
- Isopropylmethylphenols are widely used for products such as medicaments, quasi-drugs and cosmetics, as their agents such as an....
- Jan 13，2020
|
| | 3-methyl-4-propan-2-ylphenol Basic information |
| | 3-methyl-4-propan-2-ylphenol Chemical Properties |
| Melting point | 111-114 °C(lit.) | | Boiling point | 246 °C | | density | 0.9688 (estimate) | | vapor pressure | 1.81Pa at 25℃ | | refractive index | 1.5115 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 10.36±0.18(Predicted) | | color | White to Almost white | | Water Solubility | 210mg/L at 20℃ | | InChI | InChI=1S/C10H14O/c1-7(2)10-5-4-9(11)6-8(10)3/h4-7,11H,1-3H3 | | InChIKey | IJALWSVNUBBQRA-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(C(C)C)C(C)=C1 | | LogP | 3.43 | | CAS DataBase Reference | 3228-02-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | 1759 | | WGK Germany | 2 | | RTECS | GZ7170000 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29071990 |
| | 3-methyl-4-propan-2-ylphenol Usage And Synthesis |
| Chemical Properties | White crystal powder | | Uses | Isopropylmethylphenol is a useful reagent for the cross-coupling reactions. | | Definition | ChEBI: 4-Isopropyl-3-methylphenol is an alkylbenzene. | | Flammability and Explosibility | Non flammable |
| | 3-methyl-4-propan-2-ylphenol Preparation Products And Raw materials |
|