Company Name: |
Capot Chemical Co., Ltd
|
Tel: |
+86 (0) 571 85 58 67 18 |
Email: |
sales@capotchem.com |
Products Intro: |
Product Name:1,3-Dichloroadamantane CAS:16104-50-0 Purity:98% Package:1G;5G;10G;25G Remarks:Cat No.:8780
|
|
| 1,3-DICHLOROADAMANTANE Basic information |
| 1,3-DICHLOROADAMANTANE Chemical Properties |
Melting point | 130-131 °C | Boiling point | 276.3±13.0 °C(Predicted) | density | 1.25±0.1 g/cm3(Predicted) | storage temp. | 2-8°C | InChI | InChI=1S/C10H14Cl2/c11-9-2-7-1-8(4-9)5-10(12,3-7)6-9/h7-8H,1-6H2 | InChIKey | DZLCQHWJVJXVES-UHFFFAOYSA-N | SMILES | C12(Cl)CC3CC(CC(Cl)(C3)C1)C2 |
| 1,3-DICHLOROADAMANTANE Usage And Synthesis |
| 1,3-DICHLOROADAMANTANE Preparation Products And Raw materials |
|