|
|
| | 3-(3-PYRIDYL)ACRYLIC ACID Basic information |
| | 3-(3-PYRIDYL)ACRYLIC ACID Chemical Properties |
| Melting point | 232-235 °C (dec.)(lit.) | | Boiling point | 307.6±17.0 °C(Predicted) | | density | 1.261±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | form | powder | | pka | 3.13±0.10(Predicted) | | color | White | | BRN | 113290 | | InChI | InChI=1S/C8H7NO2/c10-8(11)4-3-7-2-1-5-9-6-7/h1-6H,(H,10,11)/b4-3+ | | InChIKey | VUVORVXMOLQFMO-ONEGZZNKSA-N | | SMILES | C(O)(=O)/C=C/C1=CC=CN=C1 | | CAS DataBase Reference | 19337-97-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10 | | Hazard Note | Irritant | | HS Code | 29333990 |
| | 3-(3-PYRIDYL)ACRYLIC ACID Usage And Synthesis |
| Chemical Properties | white to off-white solid | | Uses | trans-3-(3-Pyridyl)acrylic acid has been used as an organic linker to connect d and f block metals to form a 3D heterometallic coordination polymer with luminescence property. It may also be used in the synthesis of ethyl trans-3-(3-pyridyl)acrylate via esterification. | | Uses | trans-3-(3-Pyridyl)acrylic acid is a useful synthetic intermediate. It is also used to prepare aminomethyl benzimidazoles, which acts as an inhibitor of gelatinase B. Further, it is used in the preparation of aminopyridines as antibacterial enoyl acyl carrier protein reductase inhibitors. | | General Description | trans-3-(3-Pyridyl)acrylic acid, a bifunctional ligand with both hard and soft coordination sites, is mainly used in constructing heterometallic complexes. |
| | 3-(3-PYRIDYL)ACRYLIC ACID Preparation Products And Raw materials |
|