|
|
| | 2-Bromo-5-nitrothiazole Basic information |
| | 2-Bromo-5-nitrothiazole Chemical Properties |
| Melting point | 85-88 °C (dec.) (lit.) | | Boiling point | 289.7±13.0 °C(Predicted) | | density | 2.1273 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | -2.84±0.10(Predicted) | | form | Crystalline Powder | | color | Yellow to brown | | Water Solubility | Slightly soluble in water. | | BRN | 4856 | | InChI | InChI=1S/C3HBrN2O2S/c4-3-5-1-2(9-3)6(7)8/h1H | | InChIKey | ANIJFZVZXZQFDH-UHFFFAOYSA-N | | SMILES | S1C([N+]([O-])=O)=CN=C1Br | | CAS DataBase Reference | 3034-48-8(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Bromo-5-nitrothiazole(3034-48-8) | | EPA Substance Registry System | Thiazole, 2-bromo-5-nitro- (3034-48-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | XJ2986000 | | TSCA | Yes | | HS Code | 29339900 |
| | 2-Bromo-5-nitrothiazole Usage And Synthesis |
| Chemical Properties | YELLOW TO BROWN CRYSTALLINE POWDER | | Uses | 2-Bromo-5-nitrothiazole is used as a building block. It is used as an intermediate to produce other chemicals. | | Application | The reaction of 2-Bromo-5-nitrothiazole with weakly basic secondary aliphatic amines produces the expected 2-amino product from nucleophilic substitution of bromine. However, the reaction of isomeric 5-bromo-2-nitrothiazole with such amines produces the expected mixture of the 5-amino product and the 2-amino 5-nitrothiazole rearrangement product. |
| | 2-Bromo-5-nitrothiazole Preparation Products And Raw materials |
|