|
| 3-FLUORO-2-NITROBENZOIC ACID Basic information |
Product Name: | 3-FLUORO-2-NITROBENZOIC ACID | Synonyms: | 3-FLUORO-2-NITROBENZOIC ACID;3-Fluoro-2-nitrobenzoic acid 98+%;3-Fluoro-2-nitrobenzoic acid 99%;2-Carboxy-6-fluoronitrobenzene;3-Flooro-2-nitrobenzoic acid;Benzoic acid, 3-fluoro-2-nitro-;3-Fluoro-2-nitrobenzoic;DTGONJAUUOWYGB-UHFFFAOYSA-N | CAS: | 1000339-51-4 | MF: | C7H4FNO4 | MW: | 185.11 | EINECS: | | Product Categories: | | Mol File: | Mol File | ![3-FLUORO-2-NITROBENZOIC ACID Structure](StructureFile/ChemBookStructure21/GIF/CB2809261.gif) |
| 3-FLUORO-2-NITROBENZOIC ACID Chemical Properties |
Boiling point | 354.2±27.0 °C(Predicted) | density | 1.568±0.06 g/cm3(Predicted) | storage temp. | 2-8°C | pka | 1.85±0.10(Predicted) | form | Solid | color | Off-white | Sensitive | Air Sensitive | InChI | InChI=1S/C7H4FNO4/c8-5-3-1-2-4(7(10)11)6(5)9(12)13/h1-3H,(H,10,11) | InChIKey | DTGONJAUUOWYGB-UHFFFAOYSA-N | SMILES | C(O)(=O)C1=CC=CC(F)=C1[N+]([O-])=O |
Hazard Codes | Xi | HS Code | 2916399090 |
| 3-FLUORO-2-NITROBENZOIC ACID Usage And Synthesis |
Chemical Properties | light yellow powder |
| 3-FLUORO-2-NITROBENZOIC ACID Preparation Products And Raw materials |
|