Spiro[acridine-9(10H),9'-[9H]thioxanthene] manufacturers
|
| | Spiro[acridine-9(10H),9'-[9H]thioxanthene] Basic information |
| | Spiro[acridine-9(10H),9'-[9H]thioxanthene] Chemical Properties |
| Boiling point | 521.3±50.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | pka | 0.45±0.20(Predicted) | | InChI | InChI=1S/C25H17NS/c1-5-13-21-17(9-1)25(18-10-2-6-14-22(18)26-21)19-11-3-7-15-23(19)27-24-16-8-4-12-20(24)25/h1-16,26H | | InChIKey | JAUADISATOQBGC-UHFFFAOYSA-N | | SMILES | C1=C2C(NC3=C(C42C2=C(C=CC=C2)SC2=C4C=CC=C2)C=CC=C3)=CC=C1 |
| | Spiro[acridine-9(10H),9'-[9H]thioxanthene] Usage And Synthesis |
| Uses | Spiro[acridine-9(10H),9'-[9H]thioxanthene], also known as 10H-spiro(acridine-9,9′- thioxanthene) (TXDMAc), is commonly used in TADF emitter as a donor. The compound BPy3-TXDMAc based on Spiro[acridine-9(10H),9'-[9H]thioxanthene] can be used for OLEDs preparation. In particular, OLEDs employing BPy3-TXDMAc dopant realized maximum external quantum efficiencies (EQEs) up to 25.6%. Moreover, the nondoped device based on BPy3-TXDMAc exhibited a maximum EQE of 18.7%, accompanied by an extremely small efficiency loss of only 4.1% at the luminance of 1000 cd m-2[1].
| | References | [1] Wang L, et al. Achieving Enhanced Thermally Activated Delayed Fluorescence Rates and Shortened Exciton Lifetimes by Constructing Intramolecular Hydrogen Bonding Channels. ACS Applied Materials & Interfaces, 2019; 49: 45999–46007. |
| | Spiro[acridine-9(10H),9'-[9H]thioxanthene] Preparation Products And Raw materials |
|