4-methyl-1-phenylpentan-1-one manufacturers
|
| 4-methyl-1-phenylpentan-1-one Basic information |
Product Name: | 4-methyl-1-phenylpentan-1-one | Synonyms: | 4-methyl-1-phenylpentan-1-one;1-Phenyl-4-methyl-1-pentanone;1-Phenyl-4-methylpentane-1-one;4-Methyl-1-phenyl-1-pentanone;Isopentyl(phenyl) ketone;1-Pentanone, 4-methyl-1-phenyl- | CAS: | 2050-07-9 | MF: | C12H16O | MW: | 176.25 | EINECS: | 218-079-7 | Product Categories: | | Mol File: | 2050-07-9.mol | |
| 4-methyl-1-phenylpentan-1-one Chemical Properties |
Melting point | -1°C | Boiling point | 255.5°C (estimate) | density | 0.9623 | refractive index | 1.5330 (estimate) | solubility | soluble in Chloroform | form | Oil | color | Colorless | InChI | InChI=1S/C12H16O/c1-10(2)8-9-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 | InChIKey | WRJZDDJYWWJLIS-UHFFFAOYSA-N | SMILES | C(C1=CC=CC=C1)(=O)CCC(C)C |
| 4-methyl-1-phenylpentan-1-one Usage And Synthesis |
Uses | 4-Methyl-valerophenone is an intermediate used in the synthesis of a-Pyrrolidinoisohexanophenone (Hydrochloride) (P841230), which is a phenone derivative used for research purposes. |
| 4-methyl-1-phenylpentan-1-one Preparation Products And Raw materials |
|