- Zinc PCA
-
- $0.00 / 1kg
-
2024-07-30
- CAS:15454-75-8
- Min. Order: 1kg
- Purity: Zn 20%
- Supply Ability: 20MT
- Zinc PCA
-
- $0.00 / 25Kg/Bag
-
2024-07-30
- CAS:15454-75-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100mt
- Zine PCA
-
- $0.00 / 1KG
-
2024-07-25
- CAS:15454-75-8
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | bis(5-oxo-L-prolinato-N1,O2)zinc Basic information |
| Product Name: | bis(5-oxo-L-prolinato-N1,O2)zinc | | Synonyms: | PCA-ZN (ZINCIDONE);bis(5-oxo-L-prolinato-N1,O2)zinc;Pyroglutamic acid zinc salt;Einecs 239-473-5;Bis(5-oxo-L-prolinato)zinc;Zinc L-pyroglutamate;bis(5-oxo-L-prolinato-N1;O2)zinc | | CAS: | 15454-75-8 | | MF: | C10H12N2O6Zn | | MW: | 0 | | EINECS: | 239-473-5 | | Product Categories: | | | Mol File: | 15454-75-8.mol |  |
| | bis(5-oxo-L-prolinato-N1,O2)zinc Chemical Properties |
| density | 1.617[at 20℃] | | vapor pressure | 4.75hPa at 20℃ | | Water Solubility | 94g/L at 20℃ | | InChI | InChI=1/2C5H7NO3.Zn/c2*7-4-2-1-3(6-4)5(8)9;/h2*3H,1-2H2,(H,6,7)(H,8,9);/q;;+2/p-2/t2*3-;/s3 | | InChIKey | OWVLYQRCCIEOPF-OFRCQBLNNA-L | | SMILES | [Zn+2].C([O-])(=O)[C@@H]1CCC(N1)=O.C([O-])(=O)[C@@H]1CCC(N1)=O |&1:4,13,r| | | LogP | 1 at 25℃ |
| | bis(5-oxo-L-prolinato-N1,O2)zinc Usage And Synthesis |
| Flammability and Explosibility | Not classified |
| | bis(5-oxo-L-prolinato-N1,O2)zinc Preparation Products And Raw materials |
|