|
|
| | Diethylhexyl Butamido Triazone Basic information |
| Product Name: | Diethylhexyl Butamido Triazone | | Synonyms: | DIETHYLHEXYL BUTAMIDO TRIAZONE;DIETHYLHEXYL BUTAMIDO TRIAZONE (INCI);Bis(2-ethylhexyl) 4,4'-((6-((4-(tert-butylcarbamoyl)phenyl]amino)-1,3,5-triazine-2,4-diyl)diimino)dibenzoate;Unii-2utz0qc864;4,4'-[[6-[[4-[[(1,1-Dimethylethyl)amino]carbonyl]phenyl]amino]-1,3,5-triazine-2,4-diyl]diimino]bisbenzoic acid 1,1'-bis(2-ethylhexyl) ester;Iscotrizinol/Diethylamino Hydroxybenzoyl Hexyl Benzoate;2-ethylhexyl 4-[[4-[4-(tert-butylcarbamoyl)anilino]-6-[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate;Benzoic acid, 4,4'-[[6-[[4-[[(1,1-dimethylethyl)amino]carbonyl]phenyl]amino]-1,3,5-triazine-2,4-diyl]diimino]bis-, 1,1'-bis(2-ethylhexyl) ester | | CAS: | 154702-15-5 | | MF: | C44H59N7O5 | | MW: | 765.98 | | EINECS: | 421-450-8 | | Product Categories: | Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 154702-15-5.mol |  |
| | Diethylhexyl Butamido Triazone Chemical Properties |
| Melting point | >100°C (dec.) | | Boiling point | 241-893℃[at 101 325 Pa] | | density | 1.152 | | vapor pressure | 0-0.001Pa at 20-25℃ | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Solid | | pka | 15.31±0.46(Predicted) | | color | White to Off-White | | Water Solubility | 5μg/L at 20℃ | | BRN | 11322517 | | InChIKey | OSCJHTSDLYVCQC-UHFFFAOYSA-N | | SMILES | c1(Nc2ccc(C(=O)OCC(CC)CCCC)cc2)nc(Nc2ccc(C(=O)OCC(CC)CCCC)cc2)nc(Nc2ccc(C(=O)NC(C)(C)C)cc2)n1 | | LogP | 4.1-5.925 at 20-25℃ |
| WGK Germany | 1 | | HS Code | 2933690000 |
| | Diethylhexyl Butamido Triazone Usage And Synthesis |
| Description |
Diethylhexyl Butamido Triazone, or Iscotrizinol, is an organic, oil-soluble sun filter that absorbs UV-B radiation. Requires only very small concentrations to achieve a high Sun Protection Factor (SPF). Diethylhexyl Butamido Triazone is used in a wide range of cosmetic products to provide an appropriate Sun Protection Factor (SPF) in sunscreens or protect cosmetics against UV radiation. It is hardly absorbed by the skin, rarely leads to irritation, causes no allergic reactions, and has no evidence of any (geno)toxic or carcinogenic effect. Very soluble in cosmetic emollients and can readily be incorporated in the oily phase of emulsions. Because of its hydrophobic nature, it’s particularly suitable for water-repellent and water-resistand formulations.
| | Uses | Iscotrizinol is a triazine based organic compound that readily absorbs UVA and UVB radiation. Iscotrizinol is commonly found in sunscreen and other sun care products. | | Uses | diethylhexyl butamido triazone is a sunscreen chemical that acts as a uV filter and absorber. | | Flammability and Explosibility | Non flammable |
| | Diethylhexyl Butamido Triazone Preparation Products And Raw materials |
|