|
|
| | 2-methyl-1,3-thiazole-5-carboxylic acid Basic information |
| | 2-methyl-1,3-thiazole-5-carboxylic acid Chemical Properties |
| Melting point | 209 °C(Solv: water (7732-18-5)) | | Boiling point | 301.2±15.0 °C(Predicted) | | density | 1.418±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 3.78±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C5H5NO2S/c1-3-6-2-4(9-3)5(7)8/h2H,1H3,(H,7,8) | | InChIKey | QCXCIYPOMMIBHO-UHFFFAOYSA-N | | SMILES | S1C(C(O)=O)=CN=C1C |
| Hazard Codes | Xi | | Risk Statements | 36/37/39 | | Safety Statements | 26-37 | | RTECS | XJ3678500 | | HS Code | 29341000 |
| | 2-methyl-1,3-thiazole-5-carboxylic acid Usage And Synthesis |
| Synthesis |
To a stirred solution of 2-methyl-thiazole-5-carboxylic acid ethyl ester (1.3 g, 8.0 mmol) in dioxane (12 mL) at room temperature was added NaOH (2N, 12 mL). After 1 h the reaction mixture was neutralized with HCl (IN, 12 mL), then filtered and the collected solid dried in vacuo to give 2-methyl-1,3-thiazole-5-carboxylic acid (758 mg, 70percent) as an off white solid.
|
| | 2-methyl-1,3-thiazole-5-carboxylic acid Preparation Products And Raw materials |
|