|
| (3S)-3-(2-thienylthio)butanoic acid Basic information |
Product Name: | (3S)-3-(2-thienylthio)butanoic acid | Synonyms: | (3S)-3-(2-thienylthio)butanoic acid;(S)-3-(2-Thienylthio)butanoic acid;(S)-3-(thiophen-2-ylthio)butanoic acid;Butanoic acid, 3-(2-thienylthio)-, (3S)-;3-(thiophen-2-ylthio)butanoic acid;(3S)-3-THIOPHEN-2-YLSULFANYLBUTANOIC ACID;(3S)-3-(2-thienylthio)butyric acid | CAS: | 133359-80-5 | MF: | C8H10O2S2 | MW: | 202.29 | EINECS: | 948-811-7 | Product Categories: | | Mol File: | 133359-80-5.mol | ![(3S)-3-(2-thienylthio)butanoic acid Structure](CAS/GIF/133359-80-5.gif) |
| (3S)-3-(2-thienylthio)butanoic acid Chemical Properties |
Boiling point | 354.6±22.0 °C(Predicted) | density | 1.30 | storage temp. | 2-8°C | pka | 4.25±0.10(Predicted) | InChI | InChI=1S/C8H10O2S2/c1-6(5-7(9)10)12-8-3-2-4-11-8/h2-4,6H,5H2,1H3,(H,9,10)/t6-/m0/s1 | InChIKey | SIFFRIHCTBGQTC-LURJTMIESA-N | SMILES | C(O)(=O)C[C@@H](SC1SC=CC=1)C |
| (3S)-3-(2-thienylthio)butanoic acid Usage And Synthesis |
Uses | (3S)-3-(2-thienylthio)butanoic acid is an intermediate of Dorzolamide.
|
| (3S)-3-(2-thienylthio)butanoic acid Preparation Products And Raw materials |
|