|
| 4-Amino-2-chloro-3-fluorobenzonitrile Basic information |
| 4-Amino-2-chloro-3-fluorobenzonitrile Chemical Properties |
Boiling point | 320℃ | density | 1.42 | Fp | 147℃ | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | pka | -0.73±0.10(Predicted) | InChI | InChI=1S/C7H4ClFN2/c8-6-4(3-10)1-2-5(11)7(6)9/h1-2H,11H2 | InChIKey | XSTLYVVLZCCQOC-UHFFFAOYSA-N | SMILES | C(#N)C1=CC=C(N)C(F)=C1Cl |
| 4-Amino-2-chloro-3-fluorobenzonitrile Usage And Synthesis |
Synthesis | 4-amino-2-chloro-3-fluorobenzaldehyde or 3-Chloro-2-fluoroaniline can be used as raw materials to synthesize 4-Amino-2-chloro-3-fluorobenzonitrile. |
| 4-Amino-2-chloro-3-fluorobenzonitrile Preparation Products And Raw materials |
|