|
|
| | 3-(BENZYLOXY)CYCLOBUTANONE Basic information |
| Product Name: | 3-(BENZYLOXY)CYCLOBUTANONE | | Synonyms: | 3-(BENZYLOXY)CYCLOBUTANONE;1-(Benzyloxy)-3-oxocyclobutane, {[(3-Oxocyclobut-1-yl)oxy]methyl}benzene;3-(Benzyloxy)cyclobutan-1-one 97+%;3- (benzyloxy) -1-butanone;3-(BENZYLOXY)CYCLOBUTANONE###30830-27-4;Cyclobutanone, 3-(benzyloxy)-;3-(Benzyloxy)cyclobutan-1...;3-phenylmethoxycyclobutan-1-one | | CAS: | 30830-27-4 | | MF: | C11H12O2 | | MW: | 176.21 | | EINECS: | 800-316-6 | | Product Categories: | | | Mol File: | 30830-27-4.mol |  |
| | 3-(BENZYLOXY)CYCLOBUTANONE Chemical Properties |
| Boiling point | 285℃ | | density | 1.11 | | refractive index | 1.5225 | | Fp | 126℃ | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | clear liquid | | color | Colorless to Yellow | | InChI | InChI=1S/C11H12O2/c12-10-6-11(7-10)13-8-9-4-2-1-3-5-9/h1-5,11H,6-8H2 | | InChIKey | GPPSQLLIFNWNSB-UHFFFAOYSA-N | | SMILES | C1(=O)CC(OCC2=CC=CC=C2)C1 |
| | 3-(BENZYLOXY)CYCLOBUTANONE Usage And Synthesis |
| Uses | 3-(Benzyloxy)cyclobutanone is used as a reactant for the synthesis of cyclobutyl derivatives of 2''-deoxyadenosine 5''-triphosphate as inhibitors of HIV-1 reverse transcriptase. |
| | 3-(BENZYLOXY)CYCLOBUTANONE Preparation Products And Raw materials |
|