|
| 2,9-dibromo-1,10-phenanthroline Basic information |
Product Name: | 2,9-dibromo-1,10-phenanthroline | Synonyms: | 2,9-dibromo-1,10-phenanthroline;1,10-Phenanthroline, 2,9-dibroMo-;2,9-dibroMo-1,1phenanthroline;2,9-dibromo-1,10-phenthroline;(7-CHLORO-3,6-DIMETHYL-4-OXO-3,4-DIHYDRO-2-QUINAZOLINYL)METHYL ACETATE;2,9-dibroMo;2,9-dibromo-o-phenanthroline;2,9-dibromo-1,10-phenanthroline USP/EP/BP | CAS: | 39069-02-8 | MF: | C12H6Br2N2 | MW: | 338 | EINECS: | 1312995-182-4 | Product Categories: | | Mol File: | 39069-02-8.mol | |
| 2,9-dibromo-1,10-phenanthroline Chemical Properties |
Boiling point | 460.2±40.0 °C(Predicted) | density | 1.915 | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | pka | 2.46±0.30(Predicted) | InChI | InChI=1S/C12H6Br2N2/c13-9-5-3-7-1-2-8-4-6-10(14)16-12(8)11(7)15-9/h1-6H | InChIKey | QNLGXYVSHITTGT-UHFFFAOYSA-N | SMILES | N1C2C(=CC=C3C=2N=C(Br)C=C3)C=CC=1Br |
| 2,9-dibromo-1,10-phenanthroline Usage And Synthesis |
| 2,9-dibromo-1,10-phenanthroline Preparation Products And Raw materials |
|