|
| 2-Chloro-6-hydroxymethyl-pyridin-3-ol Basic information |
| 2-Chloro-6-hydroxymethyl-pyridin-3-ol Chemical Properties |
Melting point | 133~135℃ | Boiling point | 407.6±40.0 °C(Predicted) | density | 1.493±0.06 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | pka | 4.24±0.10(Predicted) | InChI | InChI=1S/C6H6ClNO2/c7-6-5(10)2-1-4(3-9)8-6/h1-2,9-10H,3H2 | InChIKey | NQELPILICRHYOE-UHFFFAOYSA-N | SMILES | C1(CO)=NC(Cl)=C(O)C=C1 |
| 2-Chloro-6-hydroxymethyl-pyridin-3-ol Usage And Synthesis |
Description | 2-Chloro-6-hydroxymethyl-pyridin-3-ol is a pharmaceutical intermediate compound that can be used to prepare Mcl1 inhibitors. | Uses | 2-Chloro-6-(hydroxymethyl)-3-pyridinol is useful reagent for stereoselective preparation of furopyridylethylthiopyrimidine HIV-1 reverse transcriptase inhbitors. |
| 2-Chloro-6-hydroxymethyl-pyridin-3-ol Preparation Products And Raw materials |
|