| Company Name: |
Finetech Industry Limited
|
| Tel: |
027-87465837 19945049750 |
| Email: |
sales@finetechnology-ind.com |
| Products Intro: |
Product Name:1-bromo-2-(2-fluorophenyl)benzene
CAS:1554-05-8
Purity:98% Package:1g;10g;25g;500g;1kg
|
| Company Name: |
Zhuhai Aobokai Biomedical Technology Co., Ltd.
|
| Tel: |
400-0628126 |
| Email: |
sales-team@aobchem.com.cn |
| Products Intro: |
Product Name:2-Bromo-2'-fluoro-biphenyl
CAS:1554-05-8
Purity:95%+ Package:3335元/1g;2504元/500mg Remarks:22730
|
2-Fluoro-2'-Bromobiphenyl manufacturers
|
| | 2-Fluoro-2'-Bromobiphenyl Basic information |
| Product Name: | 2-Fluoro-2'-Bromobiphenyl | | Synonyms: | 2-Fluoro-2'-Bromobiphenyl;2-bromo-2'-fluoro-1,1'-Biphenyl;2-Bromo-2'-fluoro-biphenyl;1-bromo-2-(2-fluorophenyl)benzene;1,1'-Biphenyl, 2-bromo-2'-fluoro-;2-Bromo-2'-fluoro-biphenyl;2-Fluoro-2'-Bromobiphenyl;2-bromo-2'-fluoro-1,1'-biphenyl | | CAS: | 1554-05-8 | | MF: | C12H8BrF | | MW: | 251.09 | | EINECS: | | | Product Categories: | | | Mol File: | 1554-05-8.mol |  |
| | 2-Fluoro-2'-Bromobiphenyl Chemical Properties |
| Melting point | 39.5-40 °C(Solv: methanol (67-56-1)) | | Boiling point | 290.2±15.0 °C(Predicted) | | density | 1.433±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C12H8BrF/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H | | InChIKey | YNNKKNMFSBLUQN-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2F)=CC=CC=C1Br |
| | 2-Fluoro-2'-Bromobiphenyl Usage And Synthesis |
| Uses | 2-Fluoro-2'-Bromobiphenyl is a halogenated biphenyl compound used as a reagent in organic synthesis or in the preparation of anticancer inhibitors. Its derivative 2-Fluoro-4-Bromobiphenyl is a key intermediate in the manufacture of flurbiprofen, which is a non-steroidal anti-inflammatory and analgesic drug. |
| | 2-Fluoro-2'-Bromobiphenyl Preparation Products And Raw materials |
|